C16H24N2O4S — CID 95984505
N-[(2S)-2-hydroxy-2-methyl-4-methylsulfanylbutyl]-N'-(2-methoxy-5-methylphenyl)oxamide (PubChem CID 95984505) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is N-[(2S)-2-hydroxy-2-methyl-4-methylsulfanylbutyl]-N'-(2-methoxy-5-methylphenyl)oxamide.
| Compound Name | N-[(2S)-2-hydroxy-2-methyl-4-methylsulfanylbutyl]-N'-(2-methoxy-5-methylphenyl)oxamide |
|---|---|
| PubChem CID | 95984505 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N-[(2S)-2-hydroxy-2-methyl-4-methylsulfanylbutyl]-N'-(2-methoxy-5-methylphenyl)oxamide |
| SMILES | COc1ccc(C)cc1NC(=O)C(=O)NC[C@@](C)(O)CCSC |
| InChI | InChI=1S/C16H24N2O4S/c1-11-5-6-13(22-3)12(9-11)18-15(20)14(19)17-10-16(2,21)7-8-23-4/h5-6,9,21H,7-8,10H2,1-4H3,(H,17,19)(H,18,20)/t16-/m0/s1 |
| InChIKey | BQHBDQCZXCCTPT-INIZCTEOSA-N |
| XLogP | 1.56 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|