C17H19ClFNO3S — CID 90498613
3-chloro-4-fluoro-N-(2-hydroxy-2-methyl-4-phenylbutyl)benzenesulfonamide (PubChem CID 90498613) has the molecular formula C17H19ClFNO3S and a molecular weight of 371.86 g/mol. Its IUPAC name is 3-chloro-4-fluoro-N-(2-hydroxy-2-methyl-4-phenylbutyl)benzenesulfonamide.
| Compound Name | 3-chloro-4-fluoro-N-(2-hydroxy-2-methyl-4-phenylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90498613 |
| Molecular Formula | C17H19ClFNO3S |
| Molecular Weight | 371.86 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 3-chloro-4-fluoro-N-(2-hydroxy-2-methyl-4-phenylbutyl)benzenesulfonamide |
| SMILES | CC(O)(CCc1ccccc1)CNS(=O)(=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C17H19ClFNO3S/c1-17(21,10-9-13-5-3-2-4-6-13)12-20-24(22,23)14-7-8-16(19)15(18)11-14/h2-8,11,20-21H,9-10,12H2,1H3 |
| InChIKey | PGZDBGNRUQIGJA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.86 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |