C20H30N2O3 — CID 90498657
N'-cycloheptyl-N-(2-hydroxy-2-methyl-4-phenylbutyl)oxamide (PubChem CID 90498657) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is N'-cycloheptyl-N-(2-hydroxy-2-methyl-4-phenylbutyl)oxamide.
| Compound Name | N'-cycloheptyl-N-(2-hydroxy-2-methyl-4-phenylbutyl)oxamide |
|---|---|
| PubChem CID | 90498657 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | N'-cycloheptyl-N-(2-hydroxy-2-methyl-4-phenylbutyl)oxamide |
| SMILES | CC(O)(CCc1ccccc1)CNC(=O)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C20H30N2O3/c1-20(25,14-13-16-9-5-4-6-10-16)15-21-18(23)19(24)22-17-11-7-2-3-8-12-17/h4-6,9-10,17,25H,2-3,7-8,11-15H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | POUONBFBDJMAOB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|