C12H22N2O3S — CID 90523164
N'-cyclopentyl-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)oxamide (PubChem CID 90523164) has the molecular formula C12H22N2O3S and a molecular weight of 274.39 g/mol. Its IUPAC name is N'-cyclopentyl-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)oxamide.
| Compound Name | N'-cyclopentyl-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)oxamide |
|---|---|
| PubChem CID | 90523164 |
| Molecular Formula | C12H22N2O3S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | N'-cyclopentyl-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)oxamide |
| SMILES | CSCC(C)(O)CNC(=O)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C12H22N2O3S/c1-12(17,8-18-2)7-13-10(15)11(16)14-9-5-3-4-6-9/h9,17H,3-8H2,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | PBHXIIRBASOEEC-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|