C19H26N2O3 — CID 90502974
1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-N-octylcyclopropane-1-carboxamide (PubChem CID 90502974) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-N-octylcyclopropane-1-carboxamide.
| Compound Name | 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-N-octylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 90502974 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-N-octylcyclopropane-1-carboxamide |
| SMILES | CCCCCCCCNC(=O)C1(c2cc(-c3ccco3)on2)CC1 |
| InChI | InChI=1S/C19H26N2O3/c1-2-3-4-5-6-7-12-20-18(22)19(10-11-19)17-14-16(24-21-17)15-9-8-13-23-15/h8-9,13-14H,2-7,10-12H2,1H3,(H,20,22) |
| InChIKey | POWNHYAUEVLSTA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|