C18H22N2O4 — CID 90503716
1-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]-N-(3-methoxypropyl)cyclopropane-1-carboxamide (PubChem CID 90503716) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 1-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]-N-(3-methoxypropyl)cyclopropane-1-carboxamide.
| Compound Name | 1-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]-N-(3-methoxypropyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 90503716 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]-N-(3-methoxypropyl)cyclopropane-1-carboxamide |
| SMILES | COCCCNC(=O)C1(c2cc(-c3cccc(OC)c3)on2)CC1 |
| InChI | InChI=1S/C18H22N2O4/c1-22-10-4-9-19-17(21)18(7-8-18)16-12-15(24-20-16)13-5-3-6-14(11-13)23-2/h3,5-6,11-12H,4,7-10H2,1-2H3,(H,19,21) |
| InChIKey | GSFVKBNMTQUHLQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|