C21H19ClN2O3 — CID 90504543
1-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-(2-phenoxyethyl)cyclopropane-1-carboxamide (PubChem CID 90504543) has the molecular formula C21H19ClN2O3 and a molecular weight of 382.85 g/mol. Its IUPAC name is 1-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-(2-phenoxyethyl)cyclopropane-1-carboxamide.
| Compound Name | 1-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-(2-phenoxyethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 90504543 |
| Molecular Formula | C21H19ClN2O3 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 1-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-(2-phenoxyethyl)cyclopropane-1-carboxamide |
| SMILES | O=C(NCCOc1ccccc1)C1(c2cc(-c3ccc(Cl)cc3)on2)CC1 |
| InChI | InChI=1S/C21H19ClN2O3/c22-16-8-6-15(7-9-16)18-14-19(24-27-18)21(10-11-21)20(25)23-12-13-26-17-4-2-1-3-5-17/h1-9,14H,10-13H2,(H,23,25) |
| InChIKey | VUCXUMSGECBTLL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|