C25H26N2O5 — CID 90503799
butyl 4-[[1-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]cyclopropanecarbonyl]amino]benzoate (PubChem CID 90503799) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is butyl 4-[[1-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]cyclopropanecarbonyl]amino]benzoate.
| Compound Name | butyl 4-[[1-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]cyclopropanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 90503799 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | butyl 4-[[1-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]cyclopropanecarbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C2(c3cc(-c4cccc(OC)c4)on3)CC2)cc1 |
| InChI | InChI=1S/C25H26N2O5/c1-3-4-14-31-23(28)17-8-10-19(11-9-17)26-24(29)25(12-13-25)22-16-21(32-27-22)18-6-5-7-20(15-18)30-2/h5-11,15-16H,3-4,12-14H2,1-2H3,(H,26,29) |
| InChIKey | GTZQUTMOEHXJAC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|