C18H18N2O4S — CID 90503904
1-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]-N-(2-oxothiolan-3-yl)cyclopropane-1-carboxamide (PubChem CID 90503904) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is 1-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]-N-(2-oxothiolan-3-yl)cyclopropane-1-carboxamide.
| Compound Name | 1-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]-N-(2-oxothiolan-3-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 90503904 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 1-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]-N-(2-oxothiolan-3-yl)cyclopropane-1-carboxamide |
| SMILES | COc1cccc(-c2cc(C3(C(=O)NC4CCSC4=O)CC3)no2)c1 |
| InChI | InChI=1S/C18H18N2O4S/c1-23-12-4-2-3-11(9-12)14-10-15(20-24-14)18(6-7-18)17(22)19-13-5-8-25-16(13)21/h2-4,9-10,13H,5-8H2,1H3,(H,19,22) |
| InChIKey | GRMUWKBOJSYRMJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|