C18H16N2O5S — CID 90504804
1-[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]-N-(2-oxothiolan-3-yl)cyclopropane-1-carboxamide (PubChem CID 90504804) has the molecular formula C18H16N2O5S and a molecular weight of 372.40 g/mol. Its IUPAC name is 1-[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]-N-(2-oxothiolan-3-yl)cyclopropane-1-carboxamide.
| Compound Name | 1-[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]-N-(2-oxothiolan-3-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 90504804 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 1-[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]-N-(2-oxothiolan-3-yl)cyclopropane-1-carboxamide |
| SMILES | O=C1SCCC1NC(=O)C1(c2cc(-c3ccc4c(c3)OCO4)on2)CC1 |
| InChI | InChI=1S/C18H16N2O5S/c21-16-11(3-6-26-16)19-17(22)18(4-5-18)15-8-13(25-20-15)10-1-2-12-14(7-10)24-9-23-12/h1-2,7-8,11H,3-6,9H2,(H,19,22) |
| InChIKey | VDZNWWDHLCPIAR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|