C16H20N2O4 — CID 110619681
N-(4-methoxybutyl)-5-(3-methoxyphenyl)-1,2-oxazole-3-carboxamide (PubChem CID 110619681) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is N-(4-methoxybutyl)-5-(3-methoxyphenyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-(4-methoxybutyl)-5-(3-methoxyphenyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 110619681 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-(4-methoxybutyl)-5-(3-methoxyphenyl)-1,2-oxazole-3-carboxamide |
| SMILES | COCCCCNC(=O)c1cc(-c2cccc(OC)c2)on1 |
| InChI | InChI=1S/C16H20N2O4/c1-20-9-4-3-8-17-16(19)14-11-15(22-18-14)12-6-5-7-13(10-12)21-2/h5-7,10-11H,3-4,8-9H2,1-2H3,(H,17,19) |
| InChIKey | OGWIFAGBXVNECN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|