C17H14N4O5 — CID 90508966
[3-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]azetidin-1-yl]-(2-methyl-3-nitrophenyl)methanone (PubChem CID 90508966) has the molecular formula C17H14N4O5 and a molecular weight of 354.32 g/mol. Its IUPAC name is [3-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]azetidin-1-yl]-(2-methyl-3-nitrophenyl)methanone.
| Compound Name | [3-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]azetidin-1-yl]-(2-methyl-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 90508966 |
| Molecular Formula | C17H14N4O5 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | [3-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]azetidin-1-yl]-(2-methyl-3-nitrophenyl)methanone |
| SMILES | Cc1c(C(=O)N2CC(c3nc(-c4ccco4)no3)C2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14N4O5/c1-10-12(4-2-5-13(10)21(23)24)17(22)20-8-11(9-20)16-18-15(19-26-16)14-6-3-7-25-14/h2-7,11H,8-9H2,1H3 |
| InChIKey | ACAQFBRYDFGAJQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 115.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|