C15H21N3O7 — CID 90511996
N,N-bis(2-methoxyethyl)-1-(5-nitrofuran-2-carbonyl)azetidine-3-carboxamide (PubChem CID 90511996) has the molecular formula C15H21N3O7 and a molecular weight of 355.35 g/mol. Its IUPAC name is N,N-bis(2-methoxyethyl)-1-(5-nitrofuran-2-carbonyl)azetidine-3-carboxamide.
| Compound Name | N,N-bis(2-methoxyethyl)-1-(5-nitrofuran-2-carbonyl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 90511996 |
| Molecular Formula | C15H21N3O7 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N,N-bis(2-methoxyethyl)-1-(5-nitrofuran-2-carbonyl)azetidine-3-carboxamide |
| SMILES | COCCN(CCOC)C(=O)C1CN(C(=O)c2ccc([N+](=O)[O-])o2)C1 |
| InChI | InChI=1S/C15H21N3O7/c1-23-7-5-16(6-8-24-2)14(19)11-9-17(10-11)15(20)12-3-4-13(25-12)18(21)22/h3-4,11H,5-10H2,1-2H3 |
| InChIKey | RSDZLYGCSPPJPF-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 115.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|