C8H14N2O3S — CID 90513052
1-methylsulfonyl-N-prop-2-enylazetidine-3-carboxamide (PubChem CID 90513052) has the molecular formula C8H14N2O3S and a molecular weight of 218.28 g/mol. Its IUPAC name is 1-methylsulfonyl-N-prop-2-enylazetidine-3-carboxamide.
| Compound Name | 1-methylsulfonyl-N-prop-2-enylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 90513052 |
| Molecular Formula | C8H14N2O3S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 1-methylsulfonyl-N-prop-2-enylazetidine-3-carboxamide |
| SMILES | C=CCNC(=O)C1CN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C8H14N2O3S/c1-3-4-9-8(11)7-5-10(6-7)14(2,12)13/h3,7H,1,4-6H2,2H3,(H,9,11) |
| InChIKey | PVZMAUFMGLJZES-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|