C15H20N2O3S — CID 90513449
1-cyclopropylsulfonyl-N-(2,5-dimethylphenyl)azetidine-3-carboxamide (PubChem CID 90513449) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is 1-cyclopropylsulfonyl-N-(2,5-dimethylphenyl)azetidine-3-carboxamide.
| Compound Name | 1-cyclopropylsulfonyl-N-(2,5-dimethylphenyl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 90513449 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 1-cyclopropylsulfonyl-N-(2,5-dimethylphenyl)azetidine-3-carboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)C2CN(S(=O)(=O)C3CC3)C2)c1 |
| InChI | InChI=1S/C15H20N2O3S/c1-10-3-4-11(2)14(7-10)16-15(18)12-8-17(9-12)21(19,20)13-5-6-13/h3-4,7,12-13H,5-6,8-9H2,1-2H3,(H,16,18) |
| InChIKey | ULMDILAVOQULRS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |