C26H35N7O — CID 90514320
N-[4-(diethylamino)-2-methylphenyl]-1-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]piperidine-4-carboxamide (PubChem CID 90514320) has the molecular formula C26H35N7O and a molecular weight of 461.61 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-1-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]piperidine-4-carboxamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-1-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 90514320 |
| Molecular Formula | C26H35N7O |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.29 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-1-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]piperidine-4-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C2CCN(c3ccc(-n4nc(C)cc4C)nn3)CC2)c(C)c1 |
| InChI | InChI=1S/C26H35N7O/c1-6-31(7-2)22-8-9-23(18(3)16-22)27-26(34)21-12-14-32(15-13-21)24-10-11-25(29-28-24)33-20(5)17-19(4)30-33/h8-11,16-17,21H,6-7,12-15H2,1-5H3,(H,27,34) |
| InChIKey | ZJXJXFXDOUAYAI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|