C23H30N8O — CID 90600388
N-[4-(diethylamino)-2-methylphenyl]-1-[6-(1,2,4-triazol-1-yl)pyrimidin-4-yl]piperidine-4-carboxamide (PubChem CID 90600388) has the molecular formula C23H30N8O and a molecular weight of 434.55 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-1-[6-(1,2,4-triazol-1-yl)pyrimidin-4-yl]piperidine-4-carboxamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-1-[6-(1,2,4-triazol-1-yl)pyrimidin-4-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 90600388 |
| Molecular Formula | C23H30N8O |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-1-[6-(1,2,4-triazol-1-yl)pyrimidin-4-yl]piperidine-4-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C2CCN(c3cc(-n4cncn4)ncn3)CC2)c(C)c1 |
| InChI | InChI=1S/C23H30N8O/c1-4-29(5-2)19-6-7-20(17(3)12-19)28-23(32)18-8-10-30(11-9-18)21-13-22(26-15-25-21)31-16-24-14-27-31/h6-7,12-16,18H,4-5,8-11H2,1-3H3,(H,28,32) |
| InChIKey | ZAFZZDDLGLKDNR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|