C14H14N6O4S — CID 90515091
2-(furan-2-carbonylamino)-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1,3-oxazole-4-carboxamide (PubChem CID 90515091) has the molecular formula C14H14N6O4S and a molecular weight of 362.37 g/mol. Its IUPAC name is 2-(furan-2-carbonylamino)-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(furan-2-carbonylamino)-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 90515091 |
| Molecular Formula | C14H14N6O4S |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 2-(furan-2-carbonylamino)-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1,3-oxazole-4-carboxamide |
| SMILES | Cn1cnnc1SCCNC(=O)c1coc(NC(=O)c2ccco2)n1 |
| InChI | InChI=1S/C14H14N6O4S/c1-20-8-16-19-14(20)25-6-4-15-11(21)9-7-24-13(17-9)18-12(22)10-3-2-5-23-10/h2-3,5,7-8H,4,6H2,1H3,(H,15,21)(H,17,18,22) |
| InChIKey | NRTSWWJBVFUNPP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|