C17H14FN3O5 — CID 90515090
N-[2-(4-fluorophenoxy)ethyl]-2-(furan-2-carbonylamino)-1,3-oxazole-4-carboxamide (PubChem CID 90515090) has the molecular formula C17H14FN3O5 and a molecular weight of 359.31 g/mol. Its IUPAC name is N-[2-(4-fluorophenoxy)ethyl]-2-(furan-2-carbonylamino)-1,3-oxazole-4-carboxamide.
| Compound Name | N-[2-(4-fluorophenoxy)ethyl]-2-(furan-2-carbonylamino)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 90515090 |
| Molecular Formula | C17H14FN3O5 |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N-[2-(4-fluorophenoxy)ethyl]-2-(furan-2-carbonylamino)-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCCOc1ccc(F)cc1)c1coc(NC(=O)c2ccco2)n1 |
| InChI | InChI=1S/C17H14FN3O5/c18-11-3-5-12(6-4-11)24-9-7-19-15(22)13-10-26-17(20-13)21-16(23)14-2-1-8-25-14/h1-6,8,10H,7,9H2,(H,19,22)(H,20,21,23) |
| InChIKey | WYRSIHFLIYZYDJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 106.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|