C16H16FN3O4 — CID 121110467
2-(cyclopropanecarbonylamino)-N-[2-(4-fluorophenoxy)ethyl]-1,3-oxazole-4-carboxamide (PubChem CID 121110467) has the molecular formula C16H16FN3O4 and a molecular weight of 333.32 g/mol. Its IUPAC name is 2-(cyclopropanecarbonylamino)-N-[2-(4-fluorophenoxy)ethyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(cyclopropanecarbonylamino)-N-[2-(4-fluorophenoxy)ethyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 121110467 |
| Molecular Formula | C16H16FN3O4 |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 2-(cyclopropanecarbonylamino)-N-[2-(4-fluorophenoxy)ethyl]-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCCOc1ccc(F)cc1)c1coc(NC(=O)C2CC2)n1 |
| InChI | InChI=1S/C16H16FN3O4/c17-11-3-5-12(6-4-11)23-8-7-18-15(22)13-9-24-16(19-13)20-14(21)10-1-2-10/h3-6,9-10H,1-2,7-8H2,(H,18,22)(H,19,20,21) |
| InChIKey | FIEAWCFJLAUDOM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|