C20H24FN3O2 — CID 90516017
2-cyclohexyl-N-[2-[4-(4-fluorophenyl)-6-oxopyrimidin-1-yl]ethyl]acetamide (PubChem CID 90516017) has the molecular formula C20H24FN3O2 and a molecular weight of 357.43 g/mol. Its IUPAC name is 2-cyclohexyl-N-[2-[4-(4-fluorophenyl)-6-oxopyrimidin-1-yl]ethyl]acetamide.
| Compound Name | 2-cyclohexyl-N-[2-[4-(4-fluorophenyl)-6-oxopyrimidin-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 90516017 |
| Molecular Formula | C20H24FN3O2 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 2-cyclohexyl-N-[2-[4-(4-fluorophenyl)-6-oxopyrimidin-1-yl]ethyl]acetamide |
| SMILES | O=C(CC1CCCCC1)NCCn1cnc(-c2ccc(F)cc2)cc1=O |
| InChI | InChI=1S/C20H24FN3O2/c21-17-8-6-16(7-9-17)18-13-20(26)24(14-23-18)11-10-22-19(25)12-15-4-2-1-3-5-15/h6-9,13-15H,1-5,10-12H2,(H,22,25) |
| InChIKey | HKQQLEQIRGOLJO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |