C18H16FN3O3S — CID 90516462
N-[2-[4-(4-fluorophenyl)-6-oxopyrimidin-1-yl]ethyl]benzenesulfonamide (PubChem CID 90516462) has the molecular formula C18H16FN3O3S and a molecular weight of 373.41 g/mol. Its IUPAC name is N-[2-[4-(4-fluorophenyl)-6-oxopyrimidin-1-yl]ethyl]benzenesulfonamide.
| Compound Name | N-[2-[4-(4-fluorophenyl)-6-oxopyrimidin-1-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90516462 |
| Molecular Formula | C18H16FN3O3S |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | N-[2-[4-(4-fluorophenyl)-6-oxopyrimidin-1-yl]ethyl]benzenesulfonamide |
| SMILES | O=c1cc(-c2ccc(F)cc2)ncn1CCNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H16FN3O3S/c19-15-8-6-14(7-9-15)17-12-18(23)22(13-20-17)11-10-21-26(24,25)16-4-2-1-3-5-16/h1-9,12-13,21H,10-11H2 |
| InChIKey | LDTDMFCFYJAQOV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |