C20H20FN3O3S — CID 90516529
N-[2-[4-(4-fluorophenyl)-6-oxopyrimidin-1-yl]ethyl]-2-phenylethanesulfonamide (PubChem CID 90516529) has the molecular formula C20H20FN3O3S and a molecular weight of 401.46 g/mol. Its IUPAC name is N-[2-[4-(4-fluorophenyl)-6-oxopyrimidin-1-yl]ethyl]-2-phenylethanesulfonamide.
| Compound Name | N-[2-[4-(4-fluorophenyl)-6-oxopyrimidin-1-yl]ethyl]-2-phenylethanesulfonamide |
|---|---|
| PubChem CID | 90516529 |
| Molecular Formula | C20H20FN3O3S |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-[2-[4-(4-fluorophenyl)-6-oxopyrimidin-1-yl]ethyl]-2-phenylethanesulfonamide |
| SMILES | O=c1cc(-c2ccc(F)cc2)ncn1CCNS(=O)(=O)CCc1ccccc1 |
| InChI | InChI=1S/C20H20FN3O3S/c21-18-8-6-17(7-9-18)19-14-20(25)24(15-22-19)12-11-23-28(26,27)13-10-16-4-2-1-3-5-16/h1-9,14-15,23H,10-13H2 |
| InChIKey | JBQLRVQZSSFNGG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |