C28H27N5O2 — CID 90517050
(2-anilinophenyl)-[4-[6-(4-methoxyphenyl)pyrimidin-4-yl]piperazin-1-yl]methanone (PubChem CID 90517050) has the molecular formula C28H27N5O2 and a molecular weight of 465.56 g/mol. Its IUPAC name is (2-anilinophenyl)-[4-[6-(4-methoxyphenyl)pyrimidin-4-yl]piperazin-1-yl]methanone.
| Compound Name | (2-anilinophenyl)-[4-[6-(4-methoxyphenyl)pyrimidin-4-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 90517050 |
| Molecular Formula | C28H27N5O2 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | (2-anilinophenyl)-[4-[6-(4-methoxyphenyl)pyrimidin-4-yl]piperazin-1-yl]methanone |
| SMILES | COc1ccc(-c2cc(N3CCN(C(=O)c4ccccc4Nc4ccccc4)CC3)ncn2)cc1 |
| InChI | InChI=1S/C28H27N5O2/c1-35-23-13-11-21(12-14-23)26-19-27(30-20-29-26)32-15-17-33(18-16-32)28(34)24-9-5-6-10-25(24)31-22-7-3-2-4-8-22/h2-14,19-20,31H,15-18H2,1H3 |
| InChIKey | JHEVRYLKPWANNT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |