C22H26N6O3 — CID 90520662
N-[2-(4-methoxyphenoxy)ethyl]-1-(6-pyrazol-1-ylpyrimidin-4-yl)piperidine-3-carboxamide (PubChem CID 90520662) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is N-[2-(4-methoxyphenoxy)ethyl]-1-(6-pyrazol-1-ylpyrimidin-4-yl)piperidine-3-carboxamide.
| Compound Name | N-[2-(4-methoxyphenoxy)ethyl]-1-(6-pyrazol-1-ylpyrimidin-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 90520662 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | N-[2-(4-methoxyphenoxy)ethyl]-1-(6-pyrazol-1-ylpyrimidin-4-yl)piperidine-3-carboxamide |
| SMILES | COc1ccc(OCCNC(=O)C2CCCN(c3cc(-n4cccn4)ncn3)C2)cc1 |
| InChI | InChI=1S/C22H26N6O3/c1-30-18-5-7-19(8-6-18)31-13-10-23-22(29)17-4-2-11-27(15-17)20-14-21(25-16-24-20)28-12-3-9-26-28/h3,5-9,12,14,16-17H,2,4,10-11,13,15H2,1H3,(H,23,29) |
| InChIKey | JLTNJEWDTLYFGL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|