C22H26N8O3 — CID 90600835
N-[4-(2-acetamidoethoxy)phenyl]-1-[6-(1,2,4-triazol-1-yl)pyrimidin-4-yl]piperidine-3-carboxamide (PubChem CID 90600835) has the molecular formula C22H26N8O3 and a molecular weight of 450.50 g/mol. Its IUPAC name is N-[4-(2-acetamidoethoxy)phenyl]-1-[6-(1,2,4-triazol-1-yl)pyrimidin-4-yl]piperidine-3-carboxamide.
| Compound Name | N-[4-(2-acetamidoethoxy)phenyl]-1-[6-(1,2,4-triazol-1-yl)pyrimidin-4-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 90600835 |
| Molecular Formula | C22H26N8O3 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | N-[4-(2-acetamidoethoxy)phenyl]-1-[6-(1,2,4-triazol-1-yl)pyrimidin-4-yl]piperidine-3-carboxamide |
| SMILES | CC(=O)NCCOc1ccc(NC(=O)C2CCCN(c3cc(-n4cncn4)ncn3)C2)cc1 |
| InChI | InChI=1S/C22H26N8O3/c1-16(31)24-8-10-33-19-6-4-18(5-7-19)28-22(32)17-3-2-9-29(12-17)20-11-21(26-14-25-20)30-15-23-13-27-30/h4-7,11,13-15,17H,2-3,8-10,12H2,1H3,(H,24,31)(H,28,32) |
| InChIKey | YFAVNFCLYDHQGZ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 127.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|