C18H17FN8O3 — CID 90600702
N-(4-fluoro-3-nitrophenyl)-1-[6-(1,2,4-triazol-1-yl)pyrimidin-4-yl]piperidine-3-carboxamide (PubChem CID 90600702) has the molecular formula C18H17FN8O3 and a molecular weight of 412.39 g/mol. Its IUPAC name is N-(4-fluoro-3-nitrophenyl)-1-[6-(1,2,4-triazol-1-yl)pyrimidin-4-yl]piperidine-3-carboxamide.
| Compound Name | N-(4-fluoro-3-nitrophenyl)-1-[6-(1,2,4-triazol-1-yl)pyrimidin-4-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 90600702 |
| Molecular Formula | C18H17FN8O3 |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N-(4-fluoro-3-nitrophenyl)-1-[6-(1,2,4-triazol-1-yl)pyrimidin-4-yl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)c([N+](=O)[O-])c1)C1CCCN(c2cc(-n3cncn3)ncn2)C1 |
| InChI | InChI=1S/C18H17FN8O3/c19-14-4-3-13(6-15(14)27(29)30)24-18(28)12-2-1-5-25(8-12)16-7-17(22-10-21-16)26-11-20-9-23-26/h3-4,6-7,9-12H,1-2,5,8H2,(H,24,28) |
| InChIKey | KFLNCCHTLBUCRH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 131.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|