C18H23ClN2O2S2 — CID 90522756
3-chloro-2-methyl-N-[2-(4-thiophen-2-ylpiperidin-1-yl)ethyl]benzenesulfonamide (PubChem CID 90522756) has the molecular formula C18H23ClN2O2S2 and a molecular weight of 398.98 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-[2-(4-thiophen-2-ylpiperidin-1-yl)ethyl]benzenesulfonamide.
| Compound Name | 3-chloro-2-methyl-N-[2-(4-thiophen-2-ylpiperidin-1-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90522756 |
| Molecular Formula | C18H23ClN2O2S2 |
| Molecular Weight | 398.98 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 3-chloro-2-methyl-N-[2-(4-thiophen-2-ylpiperidin-1-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)NCCN1CCC(c2cccs2)CC1 |
| InChI | InChI=1S/C18H23ClN2O2S2/c1-14-16(19)4-2-6-18(14)25(22,23)20-9-12-21-10-7-15(8-11-21)17-5-3-13-24-17/h2-6,13,15,20H,7-12H2,1H3 |
| InChIKey | CMIIJQIKDATBAD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.98 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |