C15H23NO3S — CID 90522997
2-(4-ethoxyphenyl)-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)acetamide (PubChem CID 90522997) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)acetamide.
| Compound Name | 2-(4-ethoxyphenyl)-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)acetamide |
|---|---|
| PubChem CID | 90522997 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2-(4-ethoxyphenyl)-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)acetamide |
| SMILES | CCOc1ccc(CC(=O)NCC(C)(O)CSC)cc1 |
| InChI | InChI=1S/C15H23NO3S/c1-4-19-13-7-5-12(6-8-13)9-14(17)16-10-15(2,18)11-20-3/h5-8,18H,4,9-11H2,1-3H3,(H,16,17) |
| InChIKey | DLJIJLVOMLIMPU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |