C17H20N2O6 — CID 90523941
N'-(2,5-dimethoxyphenyl)-N-[3-(furan-2-yl)-3-hydroxypropyl]oxamide (PubChem CID 90523941) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is N'-(2,5-dimethoxyphenyl)-N-[3-(furan-2-yl)-3-hydroxypropyl]oxamide.
| Compound Name | N'-(2,5-dimethoxyphenyl)-N-[3-(furan-2-yl)-3-hydroxypropyl]oxamide |
|---|---|
| PubChem CID | 90523941 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | N'-(2,5-dimethoxyphenyl)-N-[3-(furan-2-yl)-3-hydroxypropyl]oxamide |
| SMILES | COc1ccc(OC)c(NC(=O)C(=O)NCCC(O)c2ccco2)c1 |
| InChI | InChI=1S/C17H20N2O6/c1-23-11-5-6-14(24-2)12(10-11)19-17(22)16(21)18-8-7-13(20)15-4-3-9-25-15/h3-6,9-10,13,20H,7-8H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | CSIKSDGJLXYGKD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 110.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|