C13H20N2O4 — CID 90523886
N'-tert-butyl-N-[3-(furan-2-yl)-3-hydroxypropyl]oxamide (PubChem CID 90523886) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is N'-tert-butyl-N-[3-(furan-2-yl)-3-hydroxypropyl]oxamide.
| Compound Name | N'-tert-butyl-N-[3-(furan-2-yl)-3-hydroxypropyl]oxamide |
|---|---|
| PubChem CID | 90523886 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N'-tert-butyl-N-[3-(furan-2-yl)-3-hydroxypropyl]oxamide |
| SMILES | CC(C)(C)NC(=O)C(=O)NCCC(O)c1ccco1 |
| InChI | InChI=1S/C13H20N2O4/c1-13(2,3)15-12(18)11(17)14-7-6-9(16)10-5-4-8-19-10/h4-5,8-9,16H,6-7H2,1-3H3,(H,14,17)(H,15,18) |
| InChIKey | FDDKFAJTXBLSHS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|