C22H25NO3S — CID 90524520
N-(3-hydroxy-3-naphthalen-1-ylpropyl)-4-propylbenzenesulfonamide (PubChem CID 90524520) has the molecular formula C22H25NO3S and a molecular weight of 383.51 g/mol. Its IUPAC name is N-(3-hydroxy-3-naphthalen-1-ylpropyl)-4-propylbenzenesulfonamide.
| Compound Name | N-(3-hydroxy-3-naphthalen-1-ylpropyl)-4-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 90524520 |
| Molecular Formula | C22H25NO3S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | N-(3-hydroxy-3-naphthalen-1-ylpropyl)-4-propylbenzenesulfonamide |
| SMILES | CCCc1ccc(S(=O)(=O)NCCC(O)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C22H25NO3S/c1-2-6-17-11-13-19(14-12-17)27(25,26)23-16-15-22(24)21-10-5-8-18-7-3-4-9-20(18)21/h3-5,7-14,22-24H,2,6,15-16H2,1H3 |
| InChIKey | ZFMGNKCQNSYNKU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |