C21H23NO5S — CID 90524557
N-(3-hydroxy-3-naphthalen-1-ylpropyl)-2,4-dimethoxybenzenesulfonamide (PubChem CID 90524557) has the molecular formula C21H23NO5S and a molecular weight of 401.48 g/mol. Its IUPAC name is N-(3-hydroxy-3-naphthalen-1-ylpropyl)-2,4-dimethoxybenzenesulfonamide.
| Compound Name | N-(3-hydroxy-3-naphthalen-1-ylpropyl)-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 90524557 |
| Molecular Formula | C21H23NO5S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | N-(3-hydroxy-3-naphthalen-1-ylpropyl)-2,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCC(O)c2cccc3ccccc23)c(OC)c1 |
| InChI | InChI=1S/C21H23NO5S/c1-26-16-10-11-21(20(14-16)27-2)28(24,25)22-13-12-19(23)18-9-5-7-15-6-3-4-8-17(15)18/h3-11,14,19,22-23H,12-13H2,1-2H3 |
| InChIKey | MLRTVVJZYDYXCI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |