C22H22N2O3 — CID 90524589
N-(3-hydroxy-3-naphthalen-1-ylpropyl)-N'-(4-methylphenyl)oxamide (PubChem CID 90524589) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is N-(3-hydroxy-3-naphthalen-1-ylpropyl)-N'-(4-methylphenyl)oxamide.
| Compound Name | N-(3-hydroxy-3-naphthalen-1-ylpropyl)-N'-(4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 90524589 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-(3-hydroxy-3-naphthalen-1-ylpropyl)-N'-(4-methylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NCCC(O)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C22H22N2O3/c1-15-9-11-17(12-10-15)24-22(27)21(26)23-14-13-20(25)19-8-4-6-16-5-2-3-7-18(16)19/h2-12,20,25H,13-14H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | CNWKQWBLGQZDPS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|