C20H18N6O6S — CID 90527485
N-[5-(4,5-dimethoxy-2-nitrobenzoyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]pyrazine-2-carboxamide (PubChem CID 90527485) has the molecular formula C20H18N6O6S and a molecular weight of 470.47 g/mol. Its IUPAC name is N-[5-(4,5-dimethoxy-2-nitrobenzoyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[5-(4,5-dimethoxy-2-nitrobenzoyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 90527485 |
| Molecular Formula | C20H18N6O6S |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | N-[5-(4,5-dimethoxy-2-nitrobenzoyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]pyrazine-2-carboxamide |
| SMILES | COc1cc(C(=O)N2CCc3nc(NC(=O)c4cnccn4)sc3C2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C20H18N6O6S/c1-31-15-7-11(14(26(29)30)8-16(15)32-2)19(28)25-6-3-12-17(10-25)33-20(23-12)24-18(27)13-9-21-4-5-22-13/h4-5,7-9H,3,6,10H2,1-2H3,(H,23,24,27) |
| InChIKey | GNXVPBOCOMOHJG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|