C19H14ClN5O4S — CID 90528359
N-[5-(5-chloro-2-nitrobenzoyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]pyridine-2-carboxamide (PubChem CID 90528359) has the molecular formula C19H14ClN5O4S and a molecular weight of 443.87 g/mol. Its IUPAC name is N-[5-(5-chloro-2-nitrobenzoyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]pyridine-2-carboxamide.
| Compound Name | N-[5-(5-chloro-2-nitrobenzoyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 90528359 |
| Molecular Formula | C19H14ClN5O4S |
| Molecular Weight | 443.87 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | N-[5-(5-chloro-2-nitrobenzoyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]pyridine-2-carboxamide |
| SMILES | O=C(Nc1nc2c(s1)CN(C(=O)c1cc(Cl)ccc1[N+](=O)[O-])CC2)c1ccccn1 |
| InChI | InChI=1S/C19H14ClN5O4S/c20-11-4-5-15(25(28)29)12(9-11)18(27)24-8-6-13-16(10-24)30-19(22-13)23-17(26)14-3-1-2-7-21-14/h1-5,7,9H,6,8,10H2,(H,22,23,26) |
| InChIKey | CBRHCDSEADGNIG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 118.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.87 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|