C20H20N4O4S — CID 90529905
1-[5-(2-oxochromene-3-carbonyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]-3-propan-2-ylurea (PubChem CID 90529905) has the molecular formula C20H20N4O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is 1-[5-(2-oxochromene-3-carbonyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]-3-propan-2-ylurea.
| Compound Name | 1-[5-(2-oxochromene-3-carbonyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 90529905 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 1-[5-(2-oxochromene-3-carbonyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)Nc1nc2c(s1)CN(C(=O)c1cc3ccccc3oc1=O)CC2 |
| InChI | InChI=1S/C20H20N4O4S/c1-11(2)21-19(27)23-20-22-14-7-8-24(10-16(14)29-20)17(25)13-9-12-5-3-4-6-15(12)28-18(13)26/h3-6,9,11H,7-8,10H2,1-2H3,(H2,21,22,23,27) |
| InChIKey | KJSROKYRVXBDCE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|