C19H21NO5 — CID 90535736
N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]-3,5-dimethoxybenzamide (PubChem CID 90535736) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 90535736 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCC2(O)CCOc3ccccc32)c1 |
| InChI | InChI=1S/C19H21NO5/c1-23-14-9-13(10-15(11-14)24-2)18(21)20-12-19(22)7-8-25-17-6-4-3-5-16(17)19/h3-6,9-11,22H,7-8,12H2,1-2H3,(H,20,21) |
| InChIKey | LOPCPJOLIRXBPZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |