C18H20N2O4 — CID 90535975
1-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]-3-(3-methoxyphenyl)urea (PubChem CID 90535975) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 1-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 90535975 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 1-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)NCC2(O)CCOc3ccccc32)c1 |
| InChI | InChI=1S/C18H20N2O4/c1-23-14-6-4-5-13(11-14)20-17(21)19-12-18(22)9-10-24-16-8-3-2-7-15(16)18/h2-8,11,22H,9-10,12H2,1H3,(H2,19,20,21) |
| InChIKey | QYHZAFYIMOOWKG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |