C17H16Cl2N2O3 — CID 90535996
1-(3,4-dichlorophenyl)-3-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]urea (PubChem CID 90535996) has the molecular formula C17H16Cl2N2O3 and a molecular weight of 367.23 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]urea |
|---|---|
| PubChem CID | 90535996 |
| Molecular Formula | C17H16Cl2N2O3 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]urea |
| SMILES | O=C(NCC1(O)CCOc2ccccc21)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H16Cl2N2O3/c18-13-6-5-11(9-14(13)19)21-16(22)20-10-17(23)7-8-24-15-4-2-1-3-12(15)17/h1-6,9,23H,7-8,10H2,(H2,20,21,22) |
| InChIKey | LFPVLVCLWOEWFZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |