C11H12N2O2 — CID 90537853
N-but-3-ynyl-2-pyridin-3-yloxyacetamide (PubChem CID 90537853) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is N-but-3-ynyl-2-pyridin-3-yloxyacetamide.
| Compound Name | N-but-3-ynyl-2-pyridin-3-yloxyacetamide |
|---|---|
| PubChem CID | 90537853 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | N-but-3-ynyl-2-pyridin-3-yloxyacetamide |
| SMILES | C#CCCNC(=O)COc1cccnc1 |
| InChI | InChI=1S/C11H12N2O2/c1-2-3-7-13-11(14)9-15-10-5-4-6-12-8-10/h1,4-6,8H,3,7,9H2,(H,13,14) |
| InChIKey | CFVGPRRFCRVZKM-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|