C17H16ClN7O — CID 90539357
(2-chloro-3-pyridinyl)-[4-(6-imidazol-1-ylpyridazin-3-yl)piperazin-1-yl]methanone (PubChem CID 90539357) has the molecular formula C17H16ClN7O and a molecular weight of 369.82 g/mol. Its IUPAC name is (2-chloro-3-pyridinyl)-[4-(6-imidazol-1-ylpyridazin-3-yl)piperazin-1-yl]methanone.
| Compound Name | (2-chloro-3-pyridinyl)-[4-(6-imidazol-1-ylpyridazin-3-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 90539357 |
| Molecular Formula | C17H16ClN7O |
| Molecular Weight | 369.82 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | (2-chloro-3-pyridinyl)-[4-(6-imidazol-1-ylpyridazin-3-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cccnc1Cl)N1CCN(c2ccc(-n3ccnc3)nn2)CC1 |
| InChI | InChI=1S/C17H16ClN7O/c18-16-13(2-1-5-20-16)17(26)24-10-8-23(9-11-24)14-3-4-15(22-21-14)25-7-6-19-12-25/h1-7,12H,8-11H2 |
| InChIKey | BKBQQXPQITVQSI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.82 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|