C23H23N3O2 — CID 9054311
N-[4-(cyanomethyl)phenyl]-2-[(6-methoxynaphthalen-2-yl)methyl-methylamino]acetamide (PubChem CID 9054311) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is N-[4-(cyanomethyl)phenyl]-2-[(6-methoxynaphthalen-2-yl)methyl-methylamino]acetamide.
| Compound Name | N-[4-(cyanomethyl)phenyl]-2-[(6-methoxynaphthalen-2-yl)methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 9054311 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-[4-(cyanomethyl)phenyl]-2-[(6-methoxynaphthalen-2-yl)methyl-methylamino]acetamide |
| SMILES | COc1ccc2cc(CN(C)CC(=O)Nc3ccc(CC#N)cc3)ccc2c1 |
| InChI | InChI=1S/C23H23N3O2/c1-26(16-23(27)25-21-8-4-17(5-9-21)11-12-24)15-18-3-6-20-14-22(28-2)10-7-19(20)13-18/h3-10,13-14H,11,15-16H2,1-2H3,(H,25,27) |
| InChIKey | FDXOKEGJVVSXON-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |