C22H22N6O — CID 90545378
(E)-N-[6-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 90545378) has the molecular formula C22H22N6O and a molecular weight of 386.46 g/mol. Its IUPAC name is (E)-N-[6-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[6-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 90545378 |
| Molecular Formula | C22H22N6O |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | (E)-N-[6-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccnc1)Nc1cc(N2CCN(c3ccccc3)CC2)ncn1 |
| InChI | InChI=1S/C22H22N6O/c29-22(9-8-18-5-4-10-23-16-18)26-20-15-21(25-17-24-20)28-13-11-27(12-14-28)19-6-2-1-3-7-19/h1-10,15-17H,11-14H2,(H,24,25,26,29)/b9-8+ |
| InChIKey | SXRGPNYRXWGVRB-CMDGGOBGSA-N |
| XLogP | 2.85 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|