C15H19N5OS — CID 90546262
1-[6-(4-methylpiperidin-1-yl)pyrimidin-4-yl]-3-thiophen-2-ylurea (PubChem CID 90546262) has the molecular formula C15H19N5OS and a molecular weight of 317.42 g/mol. Its IUPAC name is 1-[6-(4-methylpiperidin-1-yl)pyrimidin-4-yl]-3-thiophen-2-ylurea.
| Compound Name | 1-[6-(4-methylpiperidin-1-yl)pyrimidin-4-yl]-3-thiophen-2-ylurea |
|---|---|
| PubChem CID | 90546262 |
| Molecular Formula | C15H19N5OS |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 1-[6-(4-methylpiperidin-1-yl)pyrimidin-4-yl]-3-thiophen-2-ylurea |
| SMILES | CC1CCN(c2cc(NC(=O)Nc3cccs3)ncn2)CC1 |
| InChI | InChI=1S/C15H19N5OS/c1-11-4-6-20(7-5-11)13-9-12(16-10-17-13)18-15(21)19-14-3-2-8-22-14/h2-3,8-11H,4-7H2,1H3,(H2,16,17,18,19,21) |
| InChIKey | CCOWHASDKPWBIB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |