C22H25N3O2S — CID 90546629
1-(4-butoxyphenyl)-3-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]urea (PubChem CID 90546629) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)-3-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]urea.
| Compound Name | 1-(4-butoxyphenyl)-3-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]urea |
|---|---|
| PubChem CID | 90546629 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 1-(4-butoxyphenyl)-3-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]urea |
| SMILES | CCCCOc1ccc(NC(=O)NCc2sc(-c3ccccc3)nc2C)cc1 |
| InChI | InChI=1S/C22H25N3O2S/c1-3-4-14-27-19-12-10-18(11-13-19)25-22(26)23-15-20-16(2)24-21(28-20)17-8-6-5-7-9-17/h5-13H,3-4,14-15H2,1-2H3,(H2,23,25,26) |
| InChIKey | QIJFNQBZIYXABB-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|