C18H24N3O3S2+ — CID 9054744
[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl]-methyl-(thiophen-3-ylmethyl)azanium (PubChem CID 9054744) has the molecular formula C18H24N3O3S2+ and a molecular weight of 394.54 g/mol. Its IUPAC name is [2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl]-methyl-(thiophen-3-ylmethyl)azanium.
| Compound Name | [2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl]-methyl-(thiophen-3-ylmethyl)azanium |
|---|---|
| PubChem CID | 9054744 |
| Molecular Formula | C18H24N3O3S2+ |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | [2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl]-methyl-(thiophen-3-ylmethyl)azanium |
| SMILES | C[NH+](CC(=O)N1CCN(S(=O)(=O)c2ccccc2)CC1)Cc1ccsc1 |
| InChI | InChI=1S/C18H23N3O3S2/c1-19(13-16-7-12-25-15-16)14-18(22)20-8-10-21(11-9-20)26(23,24)17-5-3-2-4-6-17/h2-7,12,15H,8-11,13-14H2,1H3/p+1 |
| InChIKey | UHGIKRFSJJVCTM-UHFFFAOYSA-O |
| XLogP | 0.30 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |