C16H12FNOS — CID 90547793
(E)-N-[3-(2-fluorophenyl)prop-2-ynyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 90547793) has the molecular formula C16H12FNOS and a molecular weight of 285.34 g/mol. Its IUPAC name is (E)-N-[3-(2-fluorophenyl)prop-2-ynyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[3-(2-fluorophenyl)prop-2-ynyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 90547793 |
| Molecular Formula | C16H12FNOS |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | (E)-N-[3-(2-fluorophenyl)prop-2-ynyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccs1)NCC#Cc1ccccc1F |
| InChI | InChI=1S/C16H12FNOS/c17-15-8-2-1-5-13(15)6-3-11-18-16(19)10-9-14-7-4-12-20-14/h1-2,4-5,7-10,12H,11H2,(H,18,19)/b10-9+ |
| InChIKey | CGLRIULBPKOJRT-MDZDMXLPSA-N |
| XLogP | 3.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|