C16H10ClFN2O3 — CID 90547877
4-chloro-N-[3-(2-fluorophenyl)prop-2-ynyl]-3-nitrobenzamide (PubChem CID 90547877) has the molecular formula C16H10ClFN2O3 and a molecular weight of 332.72 g/mol. Its IUPAC name is 4-chloro-N-[3-(2-fluorophenyl)prop-2-ynyl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[3-(2-fluorophenyl)prop-2-ynyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 90547877 |
| Molecular Formula | C16H10ClFN2O3 |
| Molecular Weight | 332.72 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 4-chloro-N-[3-(2-fluorophenyl)prop-2-ynyl]-3-nitrobenzamide |
| SMILES | O=C(NCC#Cc1ccccc1F)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H10ClFN2O3/c17-13-8-7-12(10-15(13)20(22)23)16(21)19-9-3-5-11-4-1-2-6-14(11)18/h1-2,4,6-8,10H,9H2,(H,19,21) |
| InChIKey | ROSDMVXGLJULKE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.72 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|