C14H15ClFNO — CID 90548105
3-chloro-N-[3-(4-fluorophenyl)prop-2-ynyl]-2,2-dimethylpropanamide (PubChem CID 90548105) has the molecular formula C14H15ClFNO and a molecular weight of 267.73 g/mol. Its IUPAC name is 3-chloro-N-[3-(4-fluorophenyl)prop-2-ynyl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[3-(4-fluorophenyl)prop-2-ynyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 90548105 |
| Molecular Formula | C14H15ClFNO |
| Molecular Weight | 267.73 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 3-chloro-N-[3-(4-fluorophenyl)prop-2-ynyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CCl)C(=O)NCC#Cc1ccc(F)cc1 |
| InChI | InChI=1S/C14H15ClFNO/c1-14(2,10-15)13(18)17-9-3-4-11-5-7-12(16)8-6-11/h5-8H,9-10H2,1-2H3,(H,17,18) |
| InChIKey | WQGBSZOKXHFZAL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.73 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|